7-phenylmethoxyquinoline
Catalog No: FT-0740794
CAS No: 131802-60-3
- Chemical Name: 7-phenylmethoxyquinoline
- Molecular Formula: C16H13NO
- Molecular Weight: 235.28
- InChI Key: SIDLHXXVIBTSJZ-UHFFFAOYSA-N
- InChI: InChI=1S/C16H13NO/c1-2-5-13(6-3-1)12-18-15-9-8-14-7-4-10-17-16(14)11-15/h1-11H,12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 131802-60-3 |
|---|---|
| MF: | C16H13NO |
| Density: | 1.167 g/cm3 |
| Flash_Point: | 144.3ºC |
| Melting_Point: | N/A |
| Product_Name: | 7-Benzyloxyquinoline |
| Symbol: | GHS07 |
| Bolling_Point: | 397.9ºC at 760 mmHg |
| FW: | 235.28100 |
| Bolling_Point: | 397.9ºC at 760 mmHg |
|---|---|
| Density: | 1.167 g/cm3 |
| MF: | C16H13NO |
| LogP: | 3.81380 |
| Exact_Mass: | 235.10000 |
| Vapor_Pressure: | 3.51E-06mmHg at 25°C |
| Flash_Point: | 144.3ºC |
| FW: | 235.28100 |
| Refractive_Index: | 1.648 |
| PSA: | 22.12000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | S26-S36 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)